C12H11Br2NO — CID 104581244
2,4-dibromo-N-pent-3-ynylbenzamide (PubChem CID 104581244) has the molecular formula C12H11Br2NO and a molecular weight of 345.03 g/mol. Its IUPAC name is 2,4-dibromo-N-pent-3-ynylbenzamide.
| Compound Name | 2,4-dibromo-N-pent-3-ynylbenzamide |
|---|---|
| PubChem CID | 104581244 |
| Molecular Formula | C12H11Br2NO |
| Molecular Weight | 345.03 g/mol |
| Exact Mass | 342.92 |
| IUPAC Name | 2,4-dibromo-N-pent-3-ynylbenzamide |
| SMILES | CC#CCCNC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H11Br2NO/c1-2-3-4-7-15-12(16)10-6-5-9(13)8-11(10)14/h5-6,8H,4,7H2,1H3,(H,15,16) |
| InChIKey | WLCZEYPHZQCJHV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.03 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|