C9H8Br3NO — CID 107941215
2,4-dibromo-N-(2-bromoethyl)benzamide (PubChem CID 107941215) has the molecular formula C9H8Br3NO and a molecular weight of 385.88 g/mol. Its IUPAC name is 2,4-dibromo-N-(2-bromoethyl)benzamide.
| Compound Name | 2,4-dibromo-N-(2-bromoethyl)benzamide |
|---|---|
| PubChem CID | 107941215 |
| Molecular Formula | C9H8Br3NO |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 382.82 |
| IUPAC Name | 2,4-dibromo-N-(2-bromoethyl)benzamide |
| SMILES | O=C(NCCBr)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C9H8Br3NO/c10-3-4-13-9(14)7-2-1-6(11)5-8(7)12/h1-2,5H,3-4H2,(H,13,14) |
| InChIKey | NNZMTEBROWQCEW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|