C13H15Br2NO2 — CID 103885609
2,4-dibromo-N-(3,3-dimethyl-2-oxobutyl)benzamide (PubChem CID 103885609) has the molecular formula C13H15Br2NO2 and a molecular weight of 377.08 g/mol. Its IUPAC name is 2,4-dibromo-N-(3,3-dimethyl-2-oxobutyl)benzamide.
| Compound Name | 2,4-dibromo-N-(3,3-dimethyl-2-oxobutyl)benzamide |
|---|---|
| PubChem CID | 103885609 |
| Molecular Formula | C13H15Br2NO2 |
| Molecular Weight | 377.08 g/mol |
| Exact Mass | 374.95 |
| IUPAC Name | 2,4-dibromo-N-(3,3-dimethyl-2-oxobutyl)benzamide |
| SMILES | CC(C)(C)C(=O)CNC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H15Br2NO2/c1-13(2,3)11(17)7-16-12(18)9-5-4-8(14)6-10(9)15/h4-6H,7H2,1-3H3,(H,16,18) |
| InChIKey | QJLLWNSKIVUXGL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.08 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |