C11H11Br2F2NO2 — CID 103082574
2,4-dibromo-N-[2-(2,2-difluoroethoxy)ethyl]benzamide (PubChem CID 103082574) has the molecular formula C11H11Br2F2NO2 and a molecular weight of 387.02 g/mol. Its IUPAC name is 2,4-dibromo-N-[2-(2,2-difluoroethoxy)ethyl]benzamide.
| Compound Name | 2,4-dibromo-N-[2-(2,2-difluoroethoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 103082574 |
| Molecular Formula | C11H11Br2F2NO2 |
| Molecular Weight | 387.02 g/mol |
| Exact Mass | 384.91 |
| IUPAC Name | 2,4-dibromo-N-[2-(2,2-difluoroethoxy)ethyl]benzamide |
| SMILES | O=C(NCCOCC(F)F)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H11Br2F2NO2/c12-7-1-2-8(9(13)5-7)11(17)16-3-4-18-6-10(14)15/h1-2,5,10H,3-4,6H2,(H,16,17) |
| InChIKey | QWZZAGOTDJUSLU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.02 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|