C9H9Br2F2NO2S — CID 103082371
4,5-dibromo-N-[2-(2,2-difluoroethoxy)ethyl]thiophene-2-carboxamide (PubChem CID 103082371) has the molecular formula C9H9Br2F2NO2S and a molecular weight of 393.05 g/mol. Its IUPAC name is 4,5-dibromo-N-[2-(2,2-difluoroethoxy)ethyl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[2-(2,2-difluoroethoxy)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103082371 |
| Molecular Formula | C9H9Br2F2NO2S |
| Molecular Weight | 393.05 g/mol |
| Exact Mass | 390.87 |
| IUPAC Name | 4,5-dibromo-N-[2-(2,2-difluoroethoxy)ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCOCC(F)F)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H9Br2F2NO2S/c10-5-3-6(17-8(5)11)9(15)14-1-2-16-4-7(12)13/h3,7H,1-2,4H2,(H,14,15) |
| InChIKey | FEKHOIUTWRZFQH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.05 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|