C9H10Br3NO2S — CID 114309271
4,5-dibromo-N-[2-(2-bromoethoxy)ethyl]thiophene-2-carboxamide (PubChem CID 114309271) has the molecular formula C9H10Br3NO2S and a molecular weight of 435.96 g/mol. Its IUPAC name is 4,5-dibromo-N-[2-(2-bromoethoxy)ethyl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[2-(2-bromoethoxy)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 114309271 |
| Molecular Formula | C9H10Br3NO2S |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 432.80 |
| IUPAC Name | 4,5-dibromo-N-[2-(2-bromoethoxy)ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCOCCBr)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H10Br3NO2S/c10-1-3-15-4-2-13-9(14)7-5-6(11)8(12)16-7/h5H,1-4H2,(H,13,14) |
| InChIKey | JFKRWCPSZMMBDJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|