C12H17Br2NO2S — CID 27682675
4,5-dibromo-N-(3-butoxypropyl)thiophene-2-carboxamide (PubChem CID 27682675) has the molecular formula C12H17Br2NO2S and a molecular weight of 399.15 g/mol. Its IUPAC name is 4,5-dibromo-N-(3-butoxypropyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(3-butoxypropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 27682675 |
| Molecular Formula | C12H17Br2NO2S |
| Molecular Weight | 399.15 g/mol |
| Exact Mass | 396.93 |
| IUPAC Name | 4,5-dibromo-N-(3-butoxypropyl)thiophene-2-carboxamide |
| SMILES | CCCCOCCCNC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H17Br2NO2S/c1-2-3-6-17-7-4-5-15-12(16)10-8-9(13)11(14)18-10/h8H,2-7H2,1H3,(H,15,16) |
| InChIKey | VKSIMBZETKMSMC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.15 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|