C9H11Br2NOS — CID 29203844
4,5-dibromo-N-butylthiophene-2-carboxamide (PubChem CID 29203844) has the molecular formula C9H11Br2NOS and a molecular weight of 341.07 g/mol. Its IUPAC name is 4,5-dibromo-N-butylthiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-butylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 29203844 |
| Molecular Formula | C9H11Br2NOS |
| Molecular Weight | 341.07 g/mol |
| Exact Mass | 338.89 |
| IUPAC Name | 4,5-dibromo-N-butylthiophene-2-carboxamide |
| SMILES | CCCCNC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C9H11Br2NOS/c1-2-3-4-12-9(13)7-5-6(10)8(11)14-7/h5H,2-4H2,1H3,(H,12,13) |
| InChIKey | LSMBSZNQRGZVLC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.07 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|