C10H14Br2N2OS — CID 112726725
4,5-dibromo-N-[2-(dimethylamino)propyl]thiophene-2-carboxamide (PubChem CID 112726725) has the molecular formula C10H14Br2N2OS and a molecular weight of 370.11 g/mol. Its IUPAC name is 4,5-dibromo-N-[2-(dimethylamino)propyl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[2-(dimethylamino)propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 112726725 |
| Molecular Formula | C10H14Br2N2OS |
| Molecular Weight | 370.11 g/mol |
| Exact Mass | 367.92 |
| IUPAC Name | 4,5-dibromo-N-[2-(dimethylamino)propyl]thiophene-2-carboxamide |
| SMILES | CC(CNC(=O)c1cc(Br)c(Br)s1)N(C)C |
| InChI | InChI=1S/C10H14Br2N2OS/c1-6(14(2)3)5-13-10(15)8-4-7(11)9(12)16-8/h4,6H,5H2,1-3H3,(H,13,15) |
| InChIKey | ZXTWDUYSOXXXEO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.11 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |