C12H16Br2ClNOS — CID 106117550
4,5-dibromo-N-[2-(2-chloroethyl)pentyl]thiophene-2-carboxamide (PubChem CID 106117550) has the molecular formula C12H16Br2ClNOS and a molecular weight of 417.59 g/mol. Its IUPAC name is 4,5-dibromo-N-[2-(2-chloroethyl)pentyl]thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-[2-(2-chloroethyl)pentyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 106117550 |
| Molecular Formula | C12H16Br2ClNOS |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 414.90 |
| IUPAC Name | 4,5-dibromo-N-[2-(2-chloroethyl)pentyl]thiophene-2-carboxamide |
| SMILES | CCCC(CCCl)CNC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H16Br2ClNOS/c1-2-3-8(4-5-15)7-16-12(17)10-6-9(13)11(14)18-10/h6,8H,2-5,7H2,1H3,(H,16,17) |
| InChIKey | NQBIXHNVCYVTTB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|