C11H13Br2NO3S — CID 81064342
3-[[(4,5-dibromothiophene-2-carbonyl)amino]methyl]pentanoic acid (PubChem CID 81064342) has the molecular formula C11H13Br2NO3S and a molecular weight of 399.10 g/mol. Its IUPAC name is 3-[[(4,5-dibromothiophene-2-carbonyl)amino]methyl]pentanoic acid.
| Compound Name | 3-[[(4,5-dibromothiophene-2-carbonyl)amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 81064342 |
| Molecular Formula | C11H13Br2NO3S |
| Molecular Weight | 399.10 g/mol |
| Exact Mass | 396.90 |
| IUPAC Name | 3-[[(4,5-dibromothiophene-2-carbonyl)amino]methyl]pentanoic acid |
| SMILES | CCC(CNC(=O)c1cc(Br)c(Br)s1)CC(=O)O |
| InChI | InChI=1S/C11H13Br2NO3S/c1-2-6(3-9(15)16)5-14-11(17)8-4-7(12)10(13)18-8/h4,6H,2-3,5H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | WHFJZYAXESAWLB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.10 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |