C13H18N2O4 — CID 81065047
3-[[(1-methyl-2-oxopyridine-4-carbonyl)amino]methyl]pentanoic acid (PubChem CID 81065047) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-[[(1-methyl-2-oxopyridine-4-carbonyl)amino]methyl]pentanoic acid.
| Compound Name | 3-[[(1-methyl-2-oxopyridine-4-carbonyl)amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 81065047 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 3-[[(1-methyl-2-oxopyridine-4-carbonyl)amino]methyl]pentanoic acid |
| SMILES | CCC(CNC(=O)c1ccn(C)c(=O)c1)CC(=O)O |
| InChI | InChI=1S/C13H18N2O4/c1-3-9(6-12(17)18)8-14-13(19)10-4-5-15(2)11(16)7-10/h4-5,7,9H,3,6,8H2,1-2H3,(H,14,19)(H,17,18) |
| InChIKey | UBNZDFOSRXTFRX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |