C13H15ClFNO3 — CID 114025747
3-[[(4-chloro-3-fluorobenzoyl)amino]methyl]pentanoic acid (PubChem CID 114025747) has the molecular formula C13H15ClFNO3 and a molecular weight of 287.72 g/mol. Its IUPAC name is 3-[[(4-chloro-3-fluorobenzoyl)amino]methyl]pentanoic acid.
| Compound Name | 3-[[(4-chloro-3-fluorobenzoyl)amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 114025747 |
| Molecular Formula | C13H15ClFNO3 |
| Molecular Weight | 287.72 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 3-[[(4-chloro-3-fluorobenzoyl)amino]methyl]pentanoic acid |
| SMILES | CCC(CNC(=O)c1ccc(Cl)c(F)c1)CC(=O)O |
| InChI | InChI=1S/C13H15ClFNO3/c1-2-8(5-12(17)18)7-16-13(19)9-3-4-10(14)11(15)6-9/h3-4,6,8H,2,5,7H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | XHASDGUHFYRJJN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.72 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |