C13H15Cl2NO3 — CID 81066303
3-[[(2,6-dichlorobenzoyl)amino]methyl]pentanoic acid (PubChem CID 81066303) has the molecular formula C13H15Cl2NO3 and a molecular weight of 304.17 g/mol. Its IUPAC name is 3-[[(2,6-dichlorobenzoyl)amino]methyl]pentanoic acid.
| Compound Name | 3-[[(2,6-dichlorobenzoyl)amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 81066303 |
| Molecular Formula | C13H15Cl2NO3 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 3-[[(2,6-dichlorobenzoyl)amino]methyl]pentanoic acid |
| SMILES | CCC(CNC(=O)c1c(Cl)cccc1Cl)CC(=O)O |
| InChI | InChI=1S/C13H15Cl2NO3/c1-2-8(6-11(17)18)7-16-13(19)12-9(14)4-3-5-10(12)15/h3-5,8H,2,6-7H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | ZAEAVTBSGAAMPE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |