C13H17Cl2NO3 — CID 79547463
2,6-dichloro-N-(2,2-diethoxyethyl)benzamide (PubChem CID 79547463) has the molecular formula C13H17Cl2NO3 and a molecular weight of 306.19 g/mol. Its IUPAC name is 2,6-dichloro-N-(2,2-diethoxyethyl)benzamide.
| Compound Name | 2,6-dichloro-N-(2,2-diethoxyethyl)benzamide |
|---|---|
| PubChem CID | 79547463 |
| Molecular Formula | C13H17Cl2NO3 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2,6-dichloro-N-(2,2-diethoxyethyl)benzamide |
| SMILES | CCOC(CNC(=O)c1c(Cl)cccc1Cl)OCC |
| InChI | InChI=1S/C13H17Cl2NO3/c1-3-18-11(19-4-2)8-16-13(17)12-9(14)6-5-7-10(12)15/h5-7,11H,3-4,8H2,1-2H3,(H,16,17) |
| InChIKey | VGMHJQZUOLSHDB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|