C18H14Cl4N2O4 — CID 139970116
methyl 2,3-bis[(2,6-dichlorobenzoyl)amino]propanoate (PubChem CID 139970116) has the molecular formula C18H14Cl4N2O4 and a molecular weight of 464.13 g/mol. Its IUPAC name is methyl 2,3-bis[(2,6-dichlorobenzoyl)amino]propanoate.
| Compound Name | methyl 2,3-bis[(2,6-dichlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 139970116 |
| Molecular Formula | C18H14Cl4N2O4 |
| Molecular Weight | 464.13 g/mol |
| Exact Mass | 461.97 |
| IUPAC Name | methyl 2,3-bis[(2,6-dichlorobenzoyl)amino]propanoate |
| SMILES | COC(=O)C(CNC(=O)c1c(Cl)cccc1Cl)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H14Cl4N2O4/c1-28-18(27)13(24-17(26)15-11(21)6-3-7-12(15)22)8-23-16(25)14-9(19)4-2-5-10(14)20/h2-7,13H,8H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | RYLHVLODDHGILA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.13 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |