C18H16BrCl2NO3 — CID 59665346
methyl (2S)-3-[4-(bromomethyl)phenyl]-2-[(2,6-dichlorobenzoyl)amino]propanoate (PubChem CID 59665346) has the molecular formula C18H16BrCl2NO3 and a molecular weight of 445.14 g/mol. Its IUPAC name is methyl (2S)-3-[4-(bromomethyl)phenyl]-2-[(2,6-dichlorobenzoyl)amino]propanoate.
| Compound Name | methyl (2S)-3-[4-(bromomethyl)phenyl]-2-[(2,6-dichlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 59665346 |
| Molecular Formula | C18H16BrCl2NO3 |
| Molecular Weight | 445.14 g/mol |
| Exact Mass | 442.97 |
| IUPAC Name | methyl (2S)-3-[4-(bromomethyl)phenyl]-2-[(2,6-dichlorobenzoyl)amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(CBr)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H16BrCl2NO3/c1-25-18(24)15(9-11-5-7-12(10-19)8-6-11)22-17(23)16-13(20)3-2-4-14(16)21/h2-8,15H,9-10H2,1H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | ABGZXLGMHANYDP-HNNXBMFYSA-N |
| XLogP | 4.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.14 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|