C24H19Cl2NO4 — CID 54369932
methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-(2-formylphenyl)phenyl]propanoate (PubChem CID 54369932) has the molecular formula C24H19Cl2NO4 and a molecular weight of 456.33 g/mol. Its IUPAC name is methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-(2-formylphenyl)phenyl]propanoate.
| Compound Name | methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-(2-formylphenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 54369932 |
| Molecular Formula | C24H19Cl2NO4 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-(2-formylphenyl)phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(-c2ccccc2C=O)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H19Cl2NO4/c1-31-24(30)21(27-23(29)22-19(25)7-4-8-20(22)26)13-15-9-11-16(12-10-15)18-6-3-2-5-17(18)14-28/h2-12,14,21H,13H2,1H3,(H,27,29)/t21-/m0/s1 |
| InChIKey | USLGWOCWKVARIE-NRFANRHFSA-N |
| XLogP | 4.99 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|