C20H19Cl2NO4 — CID 59665488
methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-(4-prop-2-enoxyphenyl)propanoate (PubChem CID 59665488) has the molecular formula C20H19Cl2NO4 and a molecular weight of 408.28 g/mol. Its IUPAC name is methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-(4-prop-2-enoxyphenyl)propanoate.
| Compound Name | methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-(4-prop-2-enoxyphenyl)propanoate |
|---|---|
| PubChem CID | 59665488 |
| Molecular Formula | C20H19Cl2NO4 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-(4-prop-2-enoxyphenyl)propanoate |
| SMILES | C=CCOc1ccc(C[C@H](NC(=O)c2c(Cl)cccc2Cl)C(=O)OC)cc1 |
| InChI | InChI=1S/C20H19Cl2NO4/c1-3-11-27-14-9-7-13(8-10-14)12-17(20(25)26-2)23-19(24)18-15(21)5-4-6-16(18)22/h3-10,17H,1,11-12H2,2H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | GOCQHOLCYMBKSR-KRWDZBQOSA-N |
| XLogP | 4.07 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|