C35H29Cl4F3N2O10S — CID 158749788
methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-(4-hydroxyphenyl)propanoate;methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate (PubChem CID 158749788) has the molecular formula C35H29Cl4F3N2O10S and a molecular weight of 868.49 g/mol. Its IUPAC name is methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-(4-hydroxyphenyl)propanoate;methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate.
| Compound Name | methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-(4-hydroxyphenyl)propanoate;methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 158749788 |
| Molecular Formula | C35H29Cl4F3N2O10S |
| Molecular Weight | 868.49 g/mol |
| Exact Mass | 866.02 |
| IUPAC Name | methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-(4-hydroxyphenyl)propanoate;methyl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)c1c(Cl)cccc1Cl.COC(=O)[C@H](Cc1ccc(OS(=O)(=O)C(F)(F)F)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H14Cl2F3NO6S.C17H15Cl2NO4/c1-29-17(26)14(24-16(25)15-12(19)3-2-4-13(15)20)9-10-5-7-11(8-6-10)30-31(27,28)18(21,22)23;1-24-17(23)14(9-10-5-7-11(21)8-6-10)20-16(22)15-12(18)3-2-4-13(15)19/h2-8,14H,9H2,1H3,(H,24,25);2-8,14,21H,9H2,1H3,(H,20,22)/t2*14-/m00/s1 |
| InChIKey | INIGEHIWBZWQEK-DXZWIFNPSA-N |
| XLogP | 6.95 |
| TPSA | 174.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.49 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|