C18H20ClN3O3 — CID 175234743
methyl (2S)-2-[[2-(aminomethyl)-6-chlorobenzoyl]amino]-3-(4-aminophenyl)propanoate (PubChem CID 175234743) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(aminomethyl)-6-chlorobenzoyl]amino]-3-(4-aminophenyl)propanoate.
| Compound Name | methyl (2S)-2-[[2-(aminomethyl)-6-chlorobenzoyl]amino]-3-(4-aminophenyl)propanoate |
|---|---|
| PubChem CID | 175234743 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | methyl (2S)-2-[[2-(aminomethyl)-6-chlorobenzoyl]amino]-3-(4-aminophenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(N)cc1)NC(=O)c1c(Cl)cccc1CN |
| InChI | InChI=1S/C18H20ClN3O3/c1-25-18(24)15(9-11-5-7-13(21)8-6-11)22-17(23)16-12(10-20)3-2-4-14(16)19/h2-8,15H,9-10,20-21H2,1H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | JYBACHCNAPIXKW-HNNXBMFYSA-N |
| XLogP | 1.89 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|