C19H22N2O5 — CID 20640313
methyl (2S)-3-(4-aminophenyl)-2-[(2,6-dimethoxybenzoyl)amino]propanoate (PubChem CID 20640313) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is methyl (2S)-3-(4-aminophenyl)-2-[(2,6-dimethoxybenzoyl)amino]propanoate.
| Compound Name | methyl (2S)-3-(4-aminophenyl)-2-[(2,6-dimethoxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 20640313 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | methyl (2S)-3-(4-aminophenyl)-2-[(2,6-dimethoxybenzoyl)amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(N)cc1)NC(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C19H22N2O5/c1-24-15-5-4-6-16(25-2)17(15)18(22)21-14(19(23)26-3)11-12-7-9-13(20)10-8-12/h4-10,14H,11,20H2,1-3H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | HGDBRWLJLNSGEF-AWEZNQCLSA-N |
| XLogP | 1.80 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|