C18H19NO5 — CID 720743
methyl (2R)-2-benzamido-3-(4-hydroxy-3-methoxyphenyl)propanoate (PubChem CID 720743) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is methyl (2R)-2-benzamido-3-(4-hydroxy-3-methoxyphenyl)propanoate.
| Compound Name | methyl (2R)-2-benzamido-3-(4-hydroxy-3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 720743 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | methyl (2R)-2-benzamido-3-(4-hydroxy-3-methoxyphenyl)propanoate |
| SMILES | COC(=O)[C@@H](Cc1ccc(O)c(OC)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H19NO5/c1-23-16-11-12(8-9-15(16)20)10-14(18(22)24-2)19-17(21)13-6-4-3-5-7-13/h3-9,11,14,20H,10H2,1-2H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | BHQKUUBRJPSPKC-CQSZACIVSA-N |
| XLogP | 1.91 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |