C20H23NO6 — CID 156757787
ethyl 2-benzamido-3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate (PubChem CID 156757787) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is ethyl 2-benzamido-3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate.
| Compound Name | ethyl 2-benzamido-3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 156757787 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | ethyl 2-benzamido-3-(2-hydroxy-4,5-dimethoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(Cc1cc(OC)c(OC)cc1O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H23NO6/c1-4-27-20(24)15(21-19(23)13-8-6-5-7-9-13)10-14-11-17(25-2)18(26-3)12-16(14)22/h5-9,11-12,15,22H,4,10H2,1-3H3,(H,21,23) |
| InChIKey | PWXJHBKFCKULEI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |