C27H28N2O6 — CID 91283003
ethyl (2S)-2-benzamido-3-[2-hydroxy-4-[(4-methoxyphenyl)methylcarbamoyl]phenyl]propanoate (PubChem CID 91283003) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is ethyl (2S)-2-benzamido-3-[2-hydroxy-4-[(4-methoxyphenyl)methylcarbamoyl]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-benzamido-3-[2-hydroxy-4-[(4-methoxyphenyl)methylcarbamoyl]phenyl]propanoate |
|---|---|
| PubChem CID | 91283003 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | ethyl (2S)-2-benzamido-3-[2-hydroxy-4-[(4-methoxyphenyl)methylcarbamoyl]phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(C(=O)NCc2ccc(OC)cc2)cc1O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O6/c1-3-35-27(33)23(29-26(32)19-7-5-4-6-8-19)15-20-11-12-21(16-24(20)30)25(31)28-17-18-9-13-22(34-2)14-10-18/h4-14,16,23,30H,3,15,17H2,1-2H3,(H,28,31)(H,29,32)/t23-/m0/s1 |
| InChIKey | BVXBQUDCDUXGJS-QHCPKHFHSA-N |
| XLogP | 3.23 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |