C18H19NO6 — CID 129232233
ethyl (2S)-3-phenyl-2-[(3,4,5-trihydroxybenzoyl)amino]propanoate (PubChem CID 129232233) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is ethyl (2S)-3-phenyl-2-[(3,4,5-trihydroxybenzoyl)amino]propanoate.
| Compound Name | ethyl (2S)-3-phenyl-2-[(3,4,5-trihydroxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 129232233 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | ethyl (2S)-3-phenyl-2-[(3,4,5-trihydroxybenzoyl)amino]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)NC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C18H19NO6/c1-2-25-18(24)13(8-11-6-4-3-5-7-11)19-17(23)12-9-14(20)16(22)15(21)10-12/h3-7,9-10,13,20-22H,2,8H2,1H3,(H,19,23)/t13-/m0/s1 |
| InChIKey | ANXXLVZAXQEMEW-ZDUSSCGKSA-N |
| XLogP | 1.71 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|