C19H29NO3 — CID 10829459
ethyl (2S)-3-phenyl-2-(2-propylpentanoylamino)propanoate (PubChem CID 10829459) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is ethyl (2S)-3-phenyl-2-(2-propylpentanoylamino)propanoate.
| Compound Name | ethyl (2S)-3-phenyl-2-(2-propylpentanoylamino)propanoate |
|---|---|
| PubChem CID | 10829459 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | ethyl (2S)-3-phenyl-2-(2-propylpentanoylamino)propanoate |
| SMILES | CCCC(CCC)C(=O)N[C@@H](Cc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C19H29NO3/c1-4-10-16(11-5-2)18(21)20-17(19(22)23-6-3)14-15-12-8-7-9-13-15/h7-9,12-13,16-17H,4-6,10-11,14H2,1-3H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | DPJRGHWKVLZTKL-KRWDZBQOSA-N |
| XLogP | 3.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |