C16H17NO4 — CID 43877560
ethyl 2-(furan-2-carbonylamino)-3-phenylpropanoate (PubChem CID 43877560) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is ethyl 2-(furan-2-carbonylamino)-3-phenylpropanoate.
| Compound Name | ethyl 2-(furan-2-carbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 43877560 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | ethyl 2-(furan-2-carbonylamino)-3-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C16H17NO4/c1-2-20-16(19)13(11-12-7-4-3-5-8-12)17-15(18)14-9-6-10-21-14/h3-10,13H,2,11H2,1H3,(H,17,18) |
| InChIKey | MMGAZCRHAQDTMM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |