C23H23NO5 — CID 8578888
2-(4-methylphenoxy)ethyl (2S)-2-(furan-2-carbonylamino)-3-phenylpropanoate (PubChem CID 8578888) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-(4-methylphenoxy)ethyl (2S)-2-(furan-2-carbonylamino)-3-phenylpropanoate.
| Compound Name | 2-(4-methylphenoxy)ethyl (2S)-2-(furan-2-carbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 8578888 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-(4-methylphenoxy)ethyl (2S)-2-(furan-2-carbonylamino)-3-phenylpropanoate |
| SMILES | Cc1ccc(OCCOC(=O)[C@H](Cc2ccccc2)NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C23H23NO5/c1-17-9-11-19(12-10-17)27-14-15-29-23(26)20(16-18-6-3-2-4-7-18)24-22(25)21-8-5-13-28-21/h2-13,20H,14-16H2,1H3,(H,24,25)/t20-/m0/s1 |
| InChIKey | ZCIJEUPAZYXNSN-FQEVSTJZSA-N |
| XLogP | 3.55 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|