C18H19NO4 — CID 55936409
[(E)-but-2-enyl] (2S)-2-(furan-2-carbonylamino)-3-phenylpropanoate (PubChem CID 55936409) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is [(E)-but-2-enyl] (2S)-2-(furan-2-carbonylamino)-3-phenylpropanoate.
| Compound Name | [(E)-but-2-enyl] (2S)-2-(furan-2-carbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 55936409 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | [(E)-but-2-enyl] (2S)-2-(furan-2-carbonylamino)-3-phenylpropanoate |
| SMILES | C/C=C/COC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C18H19NO4/c1-2-3-11-23-18(21)15(13-14-8-5-4-6-9-14)19-17(20)16-10-7-12-22-16/h2-10,12,15H,11,13H2,1H3,(H,19,20)/b3-2+/t15-/m0/s1 |
| InChIKey | JDIZEXBJKZOXFW-FAAWYNLUSA-N |
| XLogP | 2.74 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|