C21H19NO7 — CID 55935790
methyl 3-[[(2S)-2-(furan-2-carbonylamino)-3-phenylpropanoyl]oxymethyl]furan-2-carboxylate (PubChem CID 55935790) has the molecular formula C21H19NO7 and a molecular weight of 397.38 g/mol. Its IUPAC name is methyl 3-[[(2S)-2-(furan-2-carbonylamino)-3-phenylpropanoyl]oxymethyl]furan-2-carboxylate.
| Compound Name | methyl 3-[[(2S)-2-(furan-2-carbonylamino)-3-phenylpropanoyl]oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 55935790 |
| Molecular Formula | C21H19NO7 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | methyl 3-[[(2S)-2-(furan-2-carbonylamino)-3-phenylpropanoyl]oxymethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1COC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C21H19NO7/c1-26-21(25)18-15(9-11-28-18)13-29-20(24)16(12-14-6-3-2-4-7-14)22-19(23)17-8-5-10-27-17/h2-11,16H,12-13H2,1H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | IVEQVNYIJUYLAI-INIZCTEOSA-N |
| XLogP | 2.74 |
| TPSA | 107.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |