C30H28N2O5 — CID 127025927
[(2S)-2-benzamido-3-phenylpropyl] (2R)-2-(furan-2-carbonylamino)-3-phenylpropanoate (PubChem CID 127025927) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is [(2S)-2-benzamido-3-phenylpropyl] (2R)-2-(furan-2-carbonylamino)-3-phenylpropanoate.
| Compound Name | [(2S)-2-benzamido-3-phenylpropyl] (2R)-2-(furan-2-carbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 127025927 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | [(2S)-2-benzamido-3-phenylpropyl] (2R)-2-(furan-2-carbonylamino)-3-phenylpropanoate |
| SMILES | O=C(N[C@H](COC(=O)[C@@H](Cc1ccccc1)NC(=O)c1ccco1)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H28N2O5/c33-28(24-15-8-3-9-16-24)31-25(19-22-11-4-1-5-12-22)21-37-30(35)26(20-23-13-6-2-7-14-23)32-29(34)27-17-10-18-36-27/h1-18,25-26H,19-21H2,(H,31,33)(H,32,34)/t25-,26+/m0/s1 |
| InChIKey | PJSHKUZLSLGFCX-IZZNHLLZSA-N |
| XLogP | 4.21 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |