C29H24N2O6 — CID 55925984
[2-(4-benzamidophenyl)-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)-3-phenylpropanoate (PubChem CID 55925984) has the molecular formula C29H24N2O6 and a molecular weight of 496.52 g/mol. Its IUPAC name is [2-(4-benzamidophenyl)-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)-3-phenylpropanoate.
| Compound Name | [2-(4-benzamidophenyl)-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 55925984 |
| Molecular Formula | C29H24N2O6 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | [2-(4-benzamidophenyl)-2-oxoethyl] (2S)-2-(furan-2-carbonylamino)-3-phenylpropanoate |
| SMILES | O=C(COC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccco1)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24N2O6/c32-25(21-13-15-23(16-14-21)30-27(33)22-10-5-2-6-11-22)19-37-29(35)24(18-20-8-3-1-4-9-20)31-28(34)26-12-7-17-36-26/h1-17,24H,18-19H2,(H,30,33)(H,31,34)/t24-/m0/s1 |
| InChIKey | JFZVJCJWJKQPEA-DEOSSOPVSA-N |
| XLogP | 4.30 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |