C22H22N2O4 — CID 78772681
3-pyridin-3-ylpropyl 2-(furan-2-carbonylamino)-3-phenylpropanoate (PubChem CID 78772681) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 2-(furan-2-carbonylamino)-3-phenylpropanoate.
| Compound Name | 3-pyridin-3-ylpropyl 2-(furan-2-carbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 78772681 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 3-pyridin-3-ylpropyl 2-(furan-2-carbonylamino)-3-phenylpropanoate |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)OCCCc1cccnc1)c1ccco1 |
| InChI | InChI=1S/C22H22N2O4/c25-21(20-11-6-13-27-20)24-19(15-17-7-2-1-3-8-17)22(26)28-14-5-10-18-9-4-12-23-16-18/h1-4,6-9,11-13,16,19H,5,10,14-15H2,(H,24,25) |
| InChIKey | SSFSBVBDDZWMPR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|