C32H27NO7 — CID 162952199
[4-(2-benzamido-3-ethoxy-3-oxopropyl)-2-benzoyloxyphenyl] benzoate (PubChem CID 162952199) has the molecular formula C32H27NO7 and a molecular weight of 537.57 g/mol. Its IUPAC name is [4-(2-benzamido-3-ethoxy-3-oxopropyl)-2-benzoyloxyphenyl] benzoate.
| Compound Name | [4-(2-benzamido-3-ethoxy-3-oxopropyl)-2-benzoyloxyphenyl] benzoate |
|---|---|
| PubChem CID | 162952199 |
| Molecular Formula | C32H27NO7 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | [4-(2-benzamido-3-ethoxy-3-oxopropyl)-2-benzoyloxyphenyl] benzoate |
| SMILES | CCOC(=O)C(Cc1ccc(OC(=O)c2ccccc2)c(OC(=O)c2ccccc2)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H27NO7/c1-2-38-32(37)26(33-29(34)23-12-6-3-7-13-23)20-22-18-19-27(39-30(35)24-14-8-4-9-15-24)28(21-22)40-31(36)25-16-10-5-11-17-25/h3-19,21,26H,2,20H2,1H3,(H,33,34) |
| InChIKey | VJLXYSISGRRTFD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|