C19H18NO6- — CID 7056901
(2R)-2-acetamido-3-(4-benzoyloxy-3-methoxyphenyl)propanoate (PubChem CID 7056901) has the molecular formula C19H18NO6- and a molecular weight of 356.35 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(4-benzoyloxy-3-methoxyphenyl)propanoate.
| Compound Name | (2R)-2-acetamido-3-(4-benzoyloxy-3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 7056901 |
| Molecular Formula | C19H18NO6- |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (2R)-2-acetamido-3-(4-benzoyloxy-3-methoxyphenyl)propanoate |
| SMILES | COc1cc(C[C@@H](NC(C)=O)C(=O)[O-])ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H19NO6/c1-12(21)20-15(18(22)23)10-13-8-9-16(17(11-13)25-2)26-19(24)14-6-4-3-5-7-14/h3-9,11,15H,10H2,1-2H3,(H,20,21)(H,22,23)/p-1/t15-/m1/s1 |
| InChIKey | HZRQRAWSGXDEDM-OAHLLOKOSA-M |
| XLogP | 0.71 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|