C18H20O5 — CID 146169890
[(2R)-3-(3,4-dimethoxyphenyl)-2-hydroxypropyl] benzoate (PubChem CID 146169890) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is [(2R)-3-(3,4-dimethoxyphenyl)-2-hydroxypropyl] benzoate.
| Compound Name | [(2R)-3-(3,4-dimethoxyphenyl)-2-hydroxypropyl] benzoate |
|---|---|
| PubChem CID | 146169890 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | [(2R)-3-(3,4-dimethoxyphenyl)-2-hydroxypropyl] benzoate |
| SMILES | COc1ccc(C[C@@H](O)COC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C18H20O5/c1-21-16-9-8-13(11-17(16)22-2)10-15(19)12-23-18(20)14-6-4-3-5-7-14/h3-9,11,15,19H,10,12H2,1-2H3/t15-/m1/s1 |
| InChIKey | RGXPFPYYFIXNEQ-OAHLLOKOSA-N |
| XLogP | 2.46 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |