C16H17NO3 — CID 14622436
[4-(2-aminoethyl)-2-methoxyphenyl] benzoate (PubChem CID 14622436) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is [4-(2-aminoethyl)-2-methoxyphenyl] benzoate.
| Compound Name | [4-(2-aminoethyl)-2-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 14622436 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | [4-(2-aminoethyl)-2-methoxyphenyl] benzoate |
| SMILES | COc1cc(CCN)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO3/c1-19-15-11-12(9-10-17)7-8-14(15)20-16(18)13-5-3-2-4-6-13/h2-8,11H,9-10,17H2,1H3 |
| InChIKey | RNHWYEKSCXNAKH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|