C10H16INO2 — CID 46741035
2-(3,4-dimethoxyphenyl)ethanamine;hydroiodide (PubChem CID 46741035) has the molecular formula C10H16INO2 and a molecular weight of 309.15 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethanamine;hydroiodide.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethanamine;hydroiodide |
|---|---|
| PubChem CID | 46741035 |
| Molecular Formula | C10H16INO2 |
| Molecular Weight | 309.15 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethanamine;hydroiodide |
| SMILES | COc1ccc(CCN)cc1OC.I |
| InChI | InChI=1S/C10H15NO2.HI/c1-12-9-4-3-8(5-6-11)7-10(9)13-2;/h3-4,7H,5-6,11H2,1-2H3;1H |
| InChIKey | WUGYGUZIWWSYGM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.15 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|