C10H15NO2 — CID 54765058
2-[3,4-bis(trideuteriomethoxy)phenyl]ethanamine (PubChem CID 54765058) has the molecular formula C10H15NO2 and a molecular weight of 187.27 g/mol. Its IUPAC name is 2-[3,4-bis(trideuteriomethoxy)phenyl]ethanamine.
| Compound Name | 2-[3,4-bis(trideuteriomethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 54765058 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.15 |
| IUPAC Name | 2-[3,4-bis(trideuteriomethoxy)phenyl]ethanamine |
| SMILES | [2H]C([2H])([2H])Oc1ccc(CCN)cc1OC([2H])([2H])[2H] |
| InChI | InChI=1S/C10H15NO2/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h3-4,7H,5-6,11H2,1-2H3/i1D3,2D3 |
| InChIKey | ANOUKFYBOAKOIR-WFGJKAKNSA-N |
| XLogP | 1.21 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |