C11H15NO3 — CID 54765059
N-[2-[3,4-bis(trideuteriomethoxy)phenyl]ethyl]formamide (PubChem CID 54765059) has the molecular formula C11H15NO3 and a molecular weight of 215.28 g/mol. Its IUPAC name is N-[2-[3,4-bis(trideuteriomethoxy)phenyl]ethyl]formamide.
| Compound Name | N-[2-[3,4-bis(trideuteriomethoxy)phenyl]ethyl]formamide |
|---|---|
| PubChem CID | 54765059 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N-[2-[3,4-bis(trideuteriomethoxy)phenyl]ethyl]formamide |
| SMILES | [2H]C([2H])([2H])Oc1ccc(CCNC=O)cc1OC([2H])([2H])[2H] |
| InChI | InChI=1S/C11H15NO3/c1-14-10-4-3-9(5-6-12-8-13)7-11(10)15-2/h3-4,7-8H,5-6H2,1-2H3,(H,12,13)/i1D3,2D3 |
| InChIKey | WUZNVFUYFDVUIC-WFGJKAKNSA-N |
| XLogP | 0.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|