C10H13N3O3 — CID 123171973
[2-amino-5-(2-formamidoethyl)phenyl] carbamate (PubChem CID 123171973) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is [2-amino-5-(2-formamidoethyl)phenyl] carbamate.
| Compound Name | [2-amino-5-(2-formamidoethyl)phenyl] carbamate |
|---|---|
| PubChem CID | 123171973 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | [2-amino-5-(2-formamidoethyl)phenyl] carbamate |
| SMILES | NC(=O)Oc1cc(CCNC=O)ccc1N |
| InChI | InChI=1S/C10H13N3O3/c11-8-2-1-7(3-4-13-6-14)5-9(8)16-10(12)15/h1-2,5-6H,3-4,11H2,(H2,12,15)(H,13,14) |
| InChIKey | YJIHBGUYWAISCD-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|