C15H20N2O5 — CID 68919389
[4-[2-(carbamoylamino)ethyl]-2-propanoyloxyphenyl] propanoate (PubChem CID 68919389) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is [4-[2-(carbamoylamino)ethyl]-2-propanoyloxyphenyl] propanoate.
| Compound Name | [4-[2-(carbamoylamino)ethyl]-2-propanoyloxyphenyl] propanoate |
|---|---|
| PubChem CID | 68919389 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [4-[2-(carbamoylamino)ethyl]-2-propanoyloxyphenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(CCNC(N)=O)cc1OC(=O)CC |
| InChI | InChI=1S/C15H20N2O5/c1-3-13(18)21-11-6-5-10(7-8-17-15(16)20)9-12(11)22-14(19)4-2/h5-6,9H,3-4,7-8H2,1-2H3,(H3,16,17,20) |
| InChIKey | IVRLOALNBNSUBI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|