C17H26N2O4 — CID 108941786
N'-butan-2-yl-N-[2-(3,4-dimethoxyphenyl)ethyl]propanediamide (PubChem CID 108941786) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is N'-butan-2-yl-N-[2-(3,4-dimethoxyphenyl)ethyl]propanediamide.
| Compound Name | N'-butan-2-yl-N-[2-(3,4-dimethoxyphenyl)ethyl]propanediamide |
|---|---|
| PubChem CID | 108941786 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | N'-butan-2-yl-N-[2-(3,4-dimethoxyphenyl)ethyl]propanediamide |
| SMILES | CCC(C)NC(=O)CC(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H26N2O4/c1-5-12(2)19-17(21)11-16(20)18-9-8-13-6-7-14(22-3)15(10-13)23-4/h6-7,10,12H,5,8-9,11H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | MPKZKTLXJKHQFH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|