C20H32N2O4 — CID 41244831
(3S)-N'-[2-(3,4-dimethoxyphenyl)ethyl]-N,N-diethyl-3-methylpentanediamide (PubChem CID 41244831) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is (3S)-N'-[2-(3,4-dimethoxyphenyl)ethyl]-N,N-diethyl-3-methylpentanediamide.
| Compound Name | (3S)-N'-[2-(3,4-dimethoxyphenyl)ethyl]-N,N-diethyl-3-methylpentanediamide |
|---|---|
| PubChem CID | 41244831 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (3S)-N'-[2-(3,4-dimethoxyphenyl)ethyl]-N,N-diethyl-3-methylpentanediamide |
| SMILES | CCN(CC)C(=O)C[C@@H](C)CC(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H32N2O4/c1-6-22(7-2)20(24)13-15(3)12-19(23)21-11-10-16-8-9-17(25-4)18(14-16)26-5/h8-9,14-15H,6-7,10-13H2,1-5H3,(H,21,23)/t15-/m0/s1 |
| InChIKey | UTXUGXJIJZYQQH-HNNXBMFYSA-N |
| XLogP | 2.65 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |