C12H23NO6 — CID 70552532
N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide;trihydrate (PubChem CID 70552532) has the molecular formula C12H23NO6 and a molecular weight of 277.32 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide;trihydrate.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide;trihydrate |
|---|---|
| PubChem CID | 70552532 |
| Molecular Formula | C12H23NO6 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide;trihydrate |
| SMILES | COc1ccc(CCNC(C)=O)cc1OC.O.O.O |
| InChI | InChI=1S/C12H17NO3.3H2O/c1-9(14)13-7-6-10-4-5-11(15-2)12(8-10)16-3;;;/h4-5,8H,6-7H2,1-3H3,(H,13,14);3*1H2 |
| InChIKey | ZXLCRWMCRPDTJL-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 142.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |