C16H26N2O3 — CID 60956837
N-butan-2-yl-3-[(3,4-dimethoxyphenyl)methylamino]propanamide (PubChem CID 60956837) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is N-butan-2-yl-3-[(3,4-dimethoxyphenyl)methylamino]propanamide.
| Compound Name | N-butan-2-yl-3-[(3,4-dimethoxyphenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 60956837 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-butan-2-yl-3-[(3,4-dimethoxyphenyl)methylamino]propanamide |
| SMILES | CCC(C)NC(=O)CCNCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H26N2O3/c1-5-12(2)18-16(19)8-9-17-11-13-6-7-14(20-3)15(10-13)21-4/h6-7,10,12,17H,5,8-9,11H2,1-4H3,(H,18,19) |
| InChIKey | XPKVQGFYUSZWGY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|