C13H15BrO4 — CID 22615901
[4-(bromomethyl)-2-propanoyloxyphenyl] propanoate (PubChem CID 22615901) has the molecular formula C13H15BrO4 and a molecular weight of 315.16 g/mol. Its IUPAC name is [4-(bromomethyl)-2-propanoyloxyphenyl] propanoate.
| Compound Name | [4-(bromomethyl)-2-propanoyloxyphenyl] propanoate |
|---|---|
| PubChem CID | 22615901 |
| Molecular Formula | C13H15BrO4 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | [4-(bromomethyl)-2-propanoyloxyphenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(CBr)cc1OC(=O)CC |
| InChI | InChI=1S/C13H15BrO4/c1-3-12(15)17-10-6-5-9(8-14)7-11(10)18-13(16)4-2/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | FNYNEEJJYZFVLZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|