C15H20N2O5 — CID 76723253
[4-(2,3-diamino-3-oxopropyl)-2-propanoyloxyphenyl] propanoate (PubChem CID 76723253) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is [4-(2,3-diamino-3-oxopropyl)-2-propanoyloxyphenyl] propanoate.
| Compound Name | [4-(2,3-diamino-3-oxopropyl)-2-propanoyloxyphenyl] propanoate |
|---|---|
| PubChem CID | 76723253 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [4-(2,3-diamino-3-oxopropyl)-2-propanoyloxyphenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(CC(N)C(N)=O)cc1OC(=O)CC |
| InChI | InChI=1S/C15H20N2O5/c1-3-13(18)21-11-6-5-9(7-10(16)15(17)20)8-12(11)22-14(19)4-2/h5-6,8,10H,3-4,7,16H2,1-2H3,(H2,17,20) |
| InChIKey | IHPUJVOZKQWASG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|