C21H33ClN2O5 — CID 46935248
[4-[(2S)-2,3-diamino-3-oxopropyl]-2-(2,2-dimethylbutanoyloxy)phenyl] 2,2-dimethylbutanoate;hydrochloride (PubChem CID 46935248) has the molecular formula C21H33ClN2O5 and a molecular weight of 428.96 g/mol. Its IUPAC name is [4-[(2S)-2,3-diamino-3-oxopropyl]-2-(2,2-dimethylbutanoyloxy)phenyl] 2,2-dimethylbutanoate;hydrochloride.
| Compound Name | [4-[(2S)-2,3-diamino-3-oxopropyl]-2-(2,2-dimethylbutanoyloxy)phenyl] 2,2-dimethylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 46935248 |
| Molecular Formula | C21H33ClN2O5 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | [4-[(2S)-2,3-diamino-3-oxopropyl]-2-(2,2-dimethylbutanoyloxy)phenyl] 2,2-dimethylbutanoate;hydrochloride |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(C[C@H](N)C(N)=O)cc1OC(=O)C(C)(C)CC.Cl |
| InChI | InChI=1S/C21H32N2O5.ClH/c1-7-20(3,4)18(25)27-15-10-9-13(11-14(22)17(23)24)12-16(15)28-19(26)21(5,6)8-2;/h9-10,12,14H,7-8,11,22H2,1-6H3,(H2,23,24);1H/t14-;/m0./s1 |
| InChIKey | QMRSWGJRZZGPTK-UQKRIMTDSA-N |
| XLogP | 3.15 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|